C10H11ClN2O2 — CID 106690686
5-(5-chlorofuran-2-yl)-4-propyl-1,2-oxazol-3-amine (PubChem CID 106690686) has the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. Its IUPAC name is 5-(5-chlorofuran-2-yl)-4-propyl-1,2-oxazol-3-amine.
| Compound Name | 5-(5-chlorofuran-2-yl)-4-propyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 106690686 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 5-(5-chlorofuran-2-yl)-4-propyl-1,2-oxazol-3-amine |
| SMILES | CCCc1c(N)noc1-c1ccc(Cl)o1 |
| InChI | InChI=1S/C10H11ClN2O2/c1-2-3-6-9(15-13-10(6)12)7-4-5-8(11)14-7/h4-5H,2-3H2,1H3,(H2,12,13) |
| InChIKey | XKAOXFCUBSSQLK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |