C13H15ClN2O — CID 107101289
5-(3-chloro-2-methylphenyl)-4-propyl-1,2-oxazol-3-amine (PubChem CID 107101289) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is 5-(3-chloro-2-methylphenyl)-4-propyl-1,2-oxazol-3-amine.
| Compound Name | 5-(3-chloro-2-methylphenyl)-4-propyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 107101289 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 5-(3-chloro-2-methylphenyl)-4-propyl-1,2-oxazol-3-amine |
| SMILES | CCCc1c(N)noc1-c1cccc(Cl)c1C |
| InChI | InChI=1S/C13H15ClN2O/c1-3-5-10-12(17-16-13(10)15)9-6-4-7-11(14)8(9)2/h4,6-7H,3,5H2,1-2H3,(H2,15,16) |
| InChIKey | HJZUVBXREQLDSK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |