C12H18ClNO — CID 106692487
1-(5-chlorofuran-2-yl)-3-methyl-N-propylbut-2-en-1-amine (PubChem CID 106692487) has the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. Its IUPAC name is 1-(5-chlorofuran-2-yl)-3-methyl-N-propylbut-2-en-1-amine.
| Compound Name | 1-(5-chlorofuran-2-yl)-3-methyl-N-propylbut-2-en-1-amine |
|---|---|
| PubChem CID | 106692487 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1-(5-chlorofuran-2-yl)-3-methyl-N-propylbut-2-en-1-amine |
| SMILES | CCCNC(C=C(C)C)c1ccc(Cl)o1 |
| InChI | InChI=1S/C12H18ClNO/c1-4-7-14-10(8-9(2)3)11-5-6-12(13)15-11/h5-6,8,10,14H,4,7H2,1-3H3 |
| InChIKey | WCUFEZBNVCEERG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|