C21H22N4O3S — CID 10669277
6-[3-[1-(2-aminophenyl)imidazol-2-yl]sulfinylpropoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 10669277) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is 6-[3-[1-(2-aminophenyl)imidazol-2-yl]sulfinylpropoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[3-[1-(2-aminophenyl)imidazol-2-yl]sulfinylpropoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 10669277 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 6-[3-[1-(2-aminophenyl)imidazol-2-yl]sulfinylpropoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Nc1ccccc1-n1ccnc1S(=O)CCCOc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C21H22N4O3S/c22-17-4-1-2-5-19(17)25-11-10-23-21(25)29(27)13-3-12-28-16-7-8-18-15(14-16)6-9-20(26)24-18/h1-2,4-5,7-8,10-11,14H,3,6,9,12-13,22H2,(H,24,26) |
| InChIKey | RAMAYPZTIRBKKV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|