C25H20N3O+ — CID 10669455
4-(9,9-dimethyl-11-oxo-8,10-dihydrobenzo[a]acridin-12-yl)benzenediazonium (PubChem CID 10669455) has the molecular formula C25H20N3O+ and a molecular weight of 378.46 g/mol. Its IUPAC name is 4-(9,9-dimethyl-11-oxo-8,10-dihydrobenzo[a]acridin-12-yl)benzenediazonium.
| Compound Name | 4-(9,9-dimethyl-11-oxo-8,10-dihydrobenzo[a]acridin-12-yl)benzenediazonium |
|---|---|
| PubChem CID | 10669455 |
| Molecular Formula | C25H20N3O+ |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 4-(9,9-dimethyl-11-oxo-8,10-dihydrobenzo[a]acridin-12-yl)benzenediazonium |
| SMILES | CC1(C)CC(=O)c2c(nc3ccc4ccccc4c3c2-c2ccc([N+]#N)cc2)C1 |
| InChI | InChI=1S/C25H20N3O/c1-25(2)13-20-24(21(29)14-25)22(16-7-10-17(28-26)11-8-16)23-18-6-4-3-5-15(18)9-12-19(23)27-20/h3-12H,13-14H2,1-2H3/q+1 |
| InChIKey | OUJCZBKNYACNFK-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 58.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|