C11H8ClF2NO2 — CID 106695138
3-chloro-4-(2,6-difluoro-3-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 106695138) has the molecular formula C11H8ClF2NO2 and a molecular weight of 259.64 g/mol. Its IUPAC name is 3-chloro-4-(2,6-difluoro-3-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-chloro-4-(2,6-difluoro-3-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 106695138 |
| Molecular Formula | C11H8ClF2NO2 |
| Molecular Weight | 259.64 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 3-chloro-4-(2,6-difluoro-3-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(F)c(C2C(=O)NC(=O)C2Cl)c1F |
| InChI | InChI=1S/C11H8ClF2NO2/c1-4-2-3-5(13)6(9(4)14)7-8(12)11(17)15-10(7)16/h2-3,7-8H,1H3,(H,15,16,17) |
| InChIKey | AEDKNYCJQDHIFU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.64 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|