5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid

C9H6N2O3S2 — CID 106696108

IUPAC5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid
SMILESCC(=O)c1sc(-c2nccs2)nc1C(=O)O
InChIInChI=1S/C9H6N2O3S2/c1-4(12)6-5(9(13)14)11-8(16-6)7-10-2-3-15-7/h2-3H,1H3,(H,13,14)
InChIKeyYTRDVQUZGAVUEF-UHFFFAOYSA-N
MW254.29 g/mol
LogP2.17
Rot. Bonds3

About 5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid

5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 106696108) has the molecular formula C9H6N2O3S2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid
PubChem CID106696108
Molecular FormulaC9H6N2O3S2
Molecular Weight254.29 g/mol
Exact Mass253.98
IUPAC Name5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid
SMILESCC(=O)c1sc(-c2nccs2)nc1C(=O)O
InChIInChI=1S/C9H6N2O3S2/c1-4(12)6-5(9(13)14)11-8(16-6)7-10-2-3-15-7/h2-3H,1H3,(H,13,14)
InChIKeyYTRDVQUZGAVUEF-UHFFFAOYSA-N
XLogP2.17
TPSA80.15 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.29
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid (CID 106696108) is 5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid is CC(=O)c1sc(-c2nccs2)nc1C(=O)O.
What is the InChIKey of 5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is YTRDVQUZGAVUEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3S2/c1-4(12)6-5(9(13)14)11-8(16-6)7-10-2-3-15-7/h2-3H,1H3,(H,13,14).
What are the key properties of 5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid?
5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 254.29 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 106696108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).