About methyl 5-acetyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylate
methyl 5-acetyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylate (PubChem CID 106697274) has the molecular formula C12H16N2O5S2
and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl 5-acetyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-acetyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylate |
| PubChem CID | 106697274 |
| Molecular Formula | C12H16N2O5S2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | methyl 5-acetyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(NC2(C)CCS(=O)(=O)C2)sc1C(C)=O |
| InChI | InChI=1S/C12H16N2O5S2/c1-7(15)9-8(10(16)19-3)13-11(20-9)14-12(2)4-5-21(17,18)6-12/h4-6H2,1-3H3,(H,13,14) |
| InChIKey | LRVQIGHAEVVAPG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 5-acetyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-acetyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 5-acetyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylate (CID 106697274) is methyl 5-acetyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 5-acetyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 5-acetyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylate is COC(=O)c1nc(NC2(C)CCS(=O)(=O)C2)sc1C(C)=O.
What is the InChIKey of methyl 5-acetyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylate?
The InChIKey is LRVQIGHAEVVAPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O5S2/c1-7(15)9-8(10(16)19-3)13-11(20-9)14-12(2)4-5-21(17,18)6-12/h4-6H2,1-3H3,(H,13,14).
What are the key properties of methyl 5-acetyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylate?
methyl 5-acetyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylate has a molecular weight of 332.40 g/mol, XLogP of 1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-acetyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 106697274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).