C13H15FO3S — CID 106700649
4-(cyclopentylsulfinylmethyl)-2-fluorobenzoic acid (PubChem CID 106700649) has the molecular formula C13H15FO3S and a molecular weight of 270.32 g/mol. Its IUPAC name is 4-(cyclopentylsulfinylmethyl)-2-fluorobenzoic acid.
| Compound Name | 4-(cyclopentylsulfinylmethyl)-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 106700649 |
| Molecular Formula | C13H15FO3S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-(cyclopentylsulfinylmethyl)-2-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(CS(=O)C2CCCC2)cc1F |
| InChI | InChI=1S/C13H15FO3S/c14-12-7-9(5-6-11(12)13(15)16)8-18(17)10-3-1-2-4-10/h5-7,10H,1-4,8H2,(H,15,16) |
| InChIKey | OTVFHVVBLMLZCN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |