C13H16Cl2N2O2 — CID 106702355
4-(2-amino-3,5-dichlorophenyl)-1-methylpiperidine-4-carboxylic acid (PubChem CID 106702355) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is 4-(2-amino-3,5-dichlorophenyl)-1-methylpiperidine-4-carboxylic acid.
| Compound Name | 4-(2-amino-3,5-dichlorophenyl)-1-methylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 106702355 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-(2-amino-3,5-dichlorophenyl)-1-methylpiperidine-4-carboxylic acid |
| SMILES | CN1CCC(C(=O)O)(c2cc(Cl)cc(Cl)c2N)CC1 |
| InChI | InChI=1S/C13H16Cl2N2O2/c1-17-4-2-13(3-5-17,12(18)19)9-6-8(14)7-10(15)11(9)16/h6-7H,2-5,16H2,1H3,(H,18,19) |
| InChIKey | ZQJSXHFLAXDYPN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|