C13H13Cl2F2NO2 — CID 106702444
1-(2-amino-3,5-dichlorophenyl)-4,4-difluorocyclohexane-1-carboxylic acid (PubChem CID 106702444) has the molecular formula C13H13Cl2F2NO2 and a molecular weight of 324.15 g/mol. Its IUPAC name is 1-(2-amino-3,5-dichlorophenyl)-4,4-difluorocyclohexane-1-carboxylic acid.
| Compound Name | 1-(2-amino-3,5-dichlorophenyl)-4,4-difluorocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106702444 |
| Molecular Formula | C13H13Cl2F2NO2 |
| Molecular Weight | 324.15 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 1-(2-amino-3,5-dichlorophenyl)-4,4-difluorocyclohexane-1-carboxylic acid |
| SMILES | Nc1c(Cl)cc(Cl)cc1C1(C(=O)O)CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H13Cl2F2NO2/c14-7-5-8(10(18)9(15)6-7)12(11(19)20)1-3-13(16,17)4-2-12/h5-6H,1-4,18H2,(H,19,20) |
| InChIKey | SSNQGYKZTXAPDC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.15 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|