C8H8Cl2F2N2O2 — CID 166132502
azanium 2-(2-amino-3,5-dichlorophenyl)-2,2-difluoroacetate (PubChem CID 166132502) has the molecular formula C8H8Cl2F2N2O2 and a molecular weight of 273.07 g/mol. Its IUPAC name is azanium 2-(2-amino-3,5-dichlorophenyl)-2,2-difluoroacetate.
| Compound Name | azanium 2-(2-amino-3,5-dichlorophenyl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 166132502 |
| Molecular Formula | C8H8Cl2F2N2O2 |
| Molecular Weight | 273.07 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | azanium 2-(2-amino-3,5-dichlorophenyl)-2,2-difluoroacetate |
| SMILES | Nc1c(Cl)cc(Cl)cc1C(F)(F)C(=O)[O-].[NH4+] |
| InChI | InChI=1S/C8H5Cl2F2NO2.H3N/c9-3-1-4(6(13)5(10)2-3)8(11,12)7(14)15;/h1-2H,13H2,(H,14,15);1H3 |
| InChIKey | HBWFMAFIYLQGII-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.07 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|