C8H8Cl2N2O2 — CID 66513030
(2S)-2-amino-2-(2-amino-3,5-dichlorophenyl)acetic acid (PubChem CID 66513030) has the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.07 g/mol. Its IUPAC name is (2S)-2-amino-2-(2-amino-3,5-dichlorophenyl)acetic acid.
| Compound Name | (2S)-2-amino-2-(2-amino-3,5-dichlorophenyl)acetic acid |
|---|---|
| PubChem CID | 66513030 |
| Molecular Formula | C8H8Cl2N2O2 |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | (2S)-2-amino-2-(2-amino-3,5-dichlorophenyl)acetic acid |
| SMILES | Nc1c(Cl)cc(Cl)cc1[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H8Cl2N2O2/c9-3-1-4(7(12)8(13)14)6(11)5(10)2-3/h1-2,7H,11-12H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | SDLXVQUQMUFHEE-ZETCQYMHSA-N |
| XLogP | 1.66 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|