C25H34O4S — CID 10670305
tert-butyl 3-(3,4-dimethoxyphenyl)sulfanyl-7-phenylheptanoate (PubChem CID 10670305) has the molecular formula C25H34O4S and a molecular weight of 430.61 g/mol. Its IUPAC name is tert-butyl 3-(3,4-dimethoxyphenyl)sulfanyl-7-phenylheptanoate.
| Compound Name | tert-butyl 3-(3,4-dimethoxyphenyl)sulfanyl-7-phenylheptanoate |
|---|---|
| PubChem CID | 10670305 |
| Molecular Formula | C25H34O4S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | tert-butyl 3-(3,4-dimethoxyphenyl)sulfanyl-7-phenylheptanoate |
| SMILES | COc1ccc(SC(CCCCc2ccccc2)CC(=O)OC(C)(C)C)cc1OC |
| InChI | InChI=1S/C25H34O4S/c1-25(2,3)29-24(26)18-20(14-10-9-13-19-11-7-6-8-12-19)30-21-15-16-22(27-4)23(17-21)28-5/h6-8,11-12,15-17,20H,9-10,13-14,18H2,1-5H3 |
| InChIKey | KPBFGKWVMMSSBQ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|