C22H29NO4S — CID 70078170
amino (2S,3R)-3-(3,4-dimethoxyphenyl)sulfanyl-2-methyl-7-phenylheptanoate (PubChem CID 70078170) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is amino (2S,3R)-3-(3,4-dimethoxyphenyl)sulfanyl-2-methyl-7-phenylheptanoate.
| Compound Name | amino (2S,3R)-3-(3,4-dimethoxyphenyl)sulfanyl-2-methyl-7-phenylheptanoate |
|---|---|
| PubChem CID | 70078170 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | amino (2S,3R)-3-(3,4-dimethoxyphenyl)sulfanyl-2-methyl-7-phenylheptanoate |
| SMILES | COc1ccc(S[C@H](CCCCc2ccccc2)[C@@H](C)C(=O)ON)cc1OC |
| InChI | InChI=1S/C22H29NO4S/c1-16(22(24)27-23)21(12-8-7-11-17-9-5-4-6-10-17)28-18-13-14-19(25-2)20(15-18)26-3/h4-6,9-10,13-16,21H,7-8,11-12,23H2,1-3H3/t16-,21-/m1/s1 |
| InChIKey | QXTFOBVRNVWUEF-IIBYNOLFSA-N |
| XLogP | 4.63 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|