C22H29NO6S — CID 54050276
(2R,3R)-3-(3,4-dimethoxyphenyl)sulfonyl-N-hydroxy-2-methyl-7-phenylheptanamide (PubChem CID 54050276) has the molecular formula C22H29NO6S and a molecular weight of 435.54 g/mol. Its IUPAC name is (2R,3R)-3-(3,4-dimethoxyphenyl)sulfonyl-N-hydroxy-2-methyl-7-phenylheptanamide.
| Compound Name | (2R,3R)-3-(3,4-dimethoxyphenyl)sulfonyl-N-hydroxy-2-methyl-7-phenylheptanamide |
|---|---|
| PubChem CID | 54050276 |
| Molecular Formula | C22H29NO6S |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | (2R,3R)-3-(3,4-dimethoxyphenyl)sulfonyl-N-hydroxy-2-methyl-7-phenylheptanamide |
| SMILES | COc1ccc(S(=O)(=O)[C@H](CCCCc2ccccc2)[C@H](C)C(=O)NO)cc1OC |
| InChI | InChI=1S/C22H29NO6S/c1-16(22(24)23-25)21(12-8-7-11-17-9-5-4-6-10-17)30(26,27)18-13-14-19(28-2)20(15-18)29-3/h4-6,9-10,13-16,21,25H,7-8,11-12H2,1-3H3,(H,23,24)/t16-,21+/m0/s1 |
| InChIKey | LSKDZXBLTZYLIP-HRAATJIYSA-N |
| XLogP | 3.40 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|