C32H32FNO7S — CID 22463244
2-[(3,4-dimethoxyphenyl)sulfonyl-[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-N-hydroxy-4-phenylbutanamide (PubChem CID 22463244) has the molecular formula C32H32FNO7S and a molecular weight of 593.67 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)sulfonyl-[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-N-hydroxy-4-phenylbutanamide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)sulfonyl-[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-N-hydroxy-4-phenylbutanamide |
|---|---|
| PubChem CID | 22463244 |
| Molecular Formula | C32H32FNO7S |
| Molecular Weight | 593.67 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)sulfonyl-[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-N-hydroxy-4-phenylbutanamide |
| SMILES | COc1ccc(S(=O)(=O)C(c2ccc(OCc3ccc(F)cc3)cc2)C(CCc2ccccc2)C(=O)NO)cc1OC |
| InChI | InChI=1S/C32H32FNO7S/c1-39-29-19-17-27(20-30(29)40-2)42(37,38)31(28(32(35)34-36)18-10-22-6-4-3-5-7-22)24-11-15-26(16-12-24)41-21-23-8-13-25(33)14-9-23/h3-9,11-17,19-20,28,31,36H,10,18,21H2,1-2H3,(H,34,35) |
| InChIKey | ZKPIBKMEUKWTKL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.67 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|