C18H21BrO3S — CID 170743974
2-bromo-1-methoxy-4-(1-phenylpentan-3-ylsulfonyl)benzene (PubChem CID 170743974) has the molecular formula C18H21BrO3S and a molecular weight of 397.33 g/mol. Its IUPAC name is 2-bromo-1-methoxy-4-(1-phenylpentan-3-ylsulfonyl)benzene.
| Compound Name | 2-bromo-1-methoxy-4-(1-phenylpentan-3-ylsulfonyl)benzene |
|---|---|
| PubChem CID | 170743974 |
| Molecular Formula | C18H21BrO3S |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-bromo-1-methoxy-4-(1-phenylpentan-3-ylsulfonyl)benzene |
| SMILES | CCC(CCc1ccccc1)S(=O)(=O)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C18H21BrO3S/c1-3-15(10-9-14-7-5-4-6-8-14)23(20,21)16-11-12-18(22-2)17(19)13-16/h4-8,11-13,15H,3,9-10H2,1-2H3 |
| InChIKey | IJVBRBIDNNFZSC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |