C19H23BrO3S — CID 170744041
2-bromo-1-methoxy-4-(6-phenylhexan-3-ylsulfonyl)benzene (PubChem CID 170744041) has the molecular formula C19H23BrO3S and a molecular weight of 411.36 g/mol. Its IUPAC name is 2-bromo-1-methoxy-4-(6-phenylhexan-3-ylsulfonyl)benzene.
| Compound Name | 2-bromo-1-methoxy-4-(6-phenylhexan-3-ylsulfonyl)benzene |
|---|---|
| PubChem CID | 170744041 |
| Molecular Formula | C19H23BrO3S |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2-bromo-1-methoxy-4-(6-phenylhexan-3-ylsulfonyl)benzene |
| SMILES | CCC(CCCc1ccccc1)S(=O)(=O)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C19H23BrO3S/c1-3-16(11-7-10-15-8-5-4-6-9-15)24(21,22)17-12-13-19(23-2)18(20)14-17/h4-6,8-9,12-14,16H,3,7,10-11H2,1-2H3 |
| InChIKey | JVAZUTBZEHDMGA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |