C23H31N3O5S — CID 46486034
4-(3,4-dimethoxyphenyl)sulfonyl-N-(4-phenylbutan-2-yl)piperazine-1-carboxamide (PubChem CID 46486034) has the molecular formula C23H31N3O5S and a molecular weight of 461.58 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)sulfonyl-N-(4-phenylbutan-2-yl)piperazine-1-carboxamide.
| Compound Name | 4-(3,4-dimethoxyphenyl)sulfonyl-N-(4-phenylbutan-2-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 46486034 |
| Molecular Formula | C23H31N3O5S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)sulfonyl-N-(4-phenylbutan-2-yl)piperazine-1-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)NC(C)CCc3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C23H31N3O5S/c1-18(9-10-19-7-5-4-6-8-19)24-23(27)25-13-15-26(16-14-25)32(28,29)20-11-12-21(30-2)22(17-20)31-3/h4-8,11-12,17-18H,9-10,13-16H2,1-3H3,(H,24,27) |
| InChIKey | KHRUBTWLBYOAOX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |