C30H36N2O7S — CID 87989865
N-hydroxy-3-[4-methoxy-3-[(1S,3R)-3-pyridin-3-yloxycyclopentyl]oxyphenyl]sulfonyl-7-phenylheptanamide (PubChem CID 87989865) has the molecular formula C30H36N2O7S and a molecular weight of 568.69 g/mol. Its IUPAC name is N-hydroxy-3-[4-methoxy-3-[(1S,3R)-3-pyridin-3-yloxycyclopentyl]oxyphenyl]sulfonyl-7-phenylheptanamide.
| Compound Name | N-hydroxy-3-[4-methoxy-3-[(1S,3R)-3-pyridin-3-yloxycyclopentyl]oxyphenyl]sulfonyl-7-phenylheptanamide |
|---|---|
| PubChem CID | 87989865 |
| Molecular Formula | C30H36N2O7S |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | N-hydroxy-3-[4-methoxy-3-[(1S,3R)-3-pyridin-3-yloxycyclopentyl]oxyphenyl]sulfonyl-7-phenylheptanamide |
| SMILES | COc1ccc(S(=O)(=O)C(CCCCc2ccccc2)CC(=O)NO)cc1O[C@H]1CC[C@@H](Oc2cccnc2)C1 |
| InChI | InChI=1S/C30H36N2O7S/c1-37-28-16-15-27(19-29(28)39-24-14-13-23(18-24)38-25-11-7-17-31-21-25)40(35,36)26(20-30(33)32-34)12-6-5-10-22-8-3-2-4-9-22/h2-4,7-9,11,15-17,19,21,23-24,26,34H,5-6,10,12-14,18,20H2,1H3,(H,32,33)/t23-,24+,26?/m1/s1 |
| InChIKey | NLQMJNFXHSEHAM-QDQVWJFBSA-N |
| XLogP | 4.92 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|