C26H30N2O8S — CID 18363210
3-(3-cyclopentyloxy-4-methoxyphenyl)sulfonyl-6-(1,3-dioxoisoindol-2-yl)-N-hydroxyhexanamide (PubChem CID 18363210) has the molecular formula C26H30N2O8S and a molecular weight of 530.60 g/mol. Its IUPAC name is 3-(3-cyclopentyloxy-4-methoxyphenyl)sulfonyl-6-(1,3-dioxoisoindol-2-yl)-N-hydroxyhexanamide.
| Compound Name | 3-(3-cyclopentyloxy-4-methoxyphenyl)sulfonyl-6-(1,3-dioxoisoindol-2-yl)-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 18363210 |
| Molecular Formula | C26H30N2O8S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 3-(3-cyclopentyloxy-4-methoxyphenyl)sulfonyl-6-(1,3-dioxoisoindol-2-yl)-N-hydroxyhexanamide |
| SMILES | COc1ccc(S(=O)(=O)C(CCCN2C(=O)c3ccccc3C2=O)CC(=O)NO)cc1OC1CCCC1 |
| InChI | InChI=1S/C26H30N2O8S/c1-35-22-13-12-19(15-23(22)36-17-7-2-3-8-17)37(33,34)18(16-24(29)27-32)9-6-14-28-25(30)20-10-4-5-11-21(20)26(28)31/h4-5,10-13,15,17-18,32H,2-3,6-9,14,16H2,1H3,(H,27,29) |
| InChIKey | FGYNRNOOSHCFPR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|