C23H26N2O5 — CID 87559865
3-(3-cyclopentyloxy-4-methoxyphenyl)-N-hydroxy-3-(3-oxo-1,2-dihydroisoindol-1-yl)propanamide (PubChem CID 87559865) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 3-(3-cyclopentyloxy-4-methoxyphenyl)-N-hydroxy-3-(3-oxo-1,2-dihydroisoindol-1-yl)propanamide.
| Compound Name | 3-(3-cyclopentyloxy-4-methoxyphenyl)-N-hydroxy-3-(3-oxo-1,2-dihydroisoindol-1-yl)propanamide |
|---|---|
| PubChem CID | 87559865 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3-(3-cyclopentyloxy-4-methoxyphenyl)-N-hydroxy-3-(3-oxo-1,2-dihydroisoindol-1-yl)propanamide |
| SMILES | COc1ccc(C(CC(=O)NO)C2NC(=O)c3ccccc32)cc1OC1CCCC1 |
| InChI | InChI=1S/C23H26N2O5/c1-29-19-11-10-14(12-20(19)30-15-6-2-3-7-15)18(13-21(26)25-28)22-16-8-4-5-9-17(16)23(27)24-22/h4-5,8-12,15,18,22,28H,2-3,6-7,13H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | LNGYQXXNOSYSLP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|