C25H25N3O5 — CID 68622990
2-[2-(3-cyclopentyloxy-4-methoxyphenyl)-3-(1,3,4-oxadiazol-2-yl)propyl]isoindole-1,3-dione (PubChem CID 68622990) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is 2-[2-(3-cyclopentyloxy-4-methoxyphenyl)-3-(1,3,4-oxadiazol-2-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(3-cyclopentyloxy-4-methoxyphenyl)-3-(1,3,4-oxadiazol-2-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 68622990 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 2-[2-(3-cyclopentyloxy-4-methoxyphenyl)-3-(1,3,4-oxadiazol-2-yl)propyl]isoindole-1,3-dione |
| SMILES | COc1ccc(C(Cc2nnco2)CN2C(=O)c3ccccc3C2=O)cc1OC1CCCC1 |
| InChI | InChI=1S/C25H25N3O5/c1-31-21-11-10-16(12-22(21)33-18-6-2-3-7-18)17(13-23-27-26-15-32-23)14-28-24(29)19-8-4-5-9-20(19)25(28)30/h4-5,8-12,15,17-18H,2-3,6-7,13-14H2,1H3 |
| InChIKey | QCZOJFQZIAWZIQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 94.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|