C25H27N3O5 — CID 142842075
N-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(1,3,4-oxadiazol-2-yl)ethyl]-2-formyl-4-methylbenzamide (PubChem CID 142842075) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(1,3,4-oxadiazol-2-yl)ethyl]-2-formyl-4-methylbenzamide.
| Compound Name | N-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(1,3,4-oxadiazol-2-yl)ethyl]-2-formyl-4-methylbenzamide |
|---|---|
| PubChem CID | 142842075 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(1,3,4-oxadiazol-2-yl)ethyl]-2-formyl-4-methylbenzamide |
| SMILES | COc1ccc(C(Cc2nnco2)NC(=O)c2ccc(C)cc2C=O)cc1OC1CCCC1 |
| InChI | InChI=1S/C25H27N3O5/c1-16-7-9-20(18(11-16)14-29)25(30)27-21(13-24-28-26-15-32-24)17-8-10-22(31-2)23(12-17)33-19-5-3-4-6-19/h7-12,14-15,19,21H,3-6,13H2,1-2H3,(H,27,30) |
| InChIKey | NGFTZMPDKRGEAP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|