C24H31N3O6 — CID 54397995
ethyl N-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-[(4-nitrophenyl)methylamino]ethyl]carbamate (PubChem CID 54397995) has the molecular formula C24H31N3O6 and a molecular weight of 457.53 g/mol. Its IUPAC name is ethyl N-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-[(4-nitrophenyl)methylamino]ethyl]carbamate.
| Compound Name | ethyl N-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-[(4-nitrophenyl)methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 54397995 |
| Molecular Formula | C24H31N3O6 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | ethyl N-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-[(4-nitrophenyl)methylamino]ethyl]carbamate |
| SMILES | CCOC(=O)NC(CNCc1ccc([N+](=O)[O-])cc1)c1ccc(OC)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C24H31N3O6/c1-3-32-24(28)26-21(16-25-15-17-8-11-19(12-9-17)27(29)30)18-10-13-22(31-2)23(14-18)33-20-6-4-5-7-20/h8-14,20-21,25H,3-7,15-16H2,1-2H3,(H,26,28) |
| InChIKey | VLJPEJBEPHRLTN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|