C29H40O4S — CID 18363186
tert-butyl 3-(4-cyclopentyloxy-3-methoxyphenyl)sulfanyl-7-phenylheptanoate (PubChem CID 18363186) has the molecular formula C29H40O4S and a molecular weight of 484.70 g/mol. Its IUPAC name is tert-butyl 3-(4-cyclopentyloxy-3-methoxyphenyl)sulfanyl-7-phenylheptanoate.
| Compound Name | tert-butyl 3-(4-cyclopentyloxy-3-methoxyphenyl)sulfanyl-7-phenylheptanoate |
|---|---|
| PubChem CID | 18363186 |
| Molecular Formula | C29H40O4S |
| Molecular Weight | 484.70 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | tert-butyl 3-(4-cyclopentyloxy-3-methoxyphenyl)sulfanyl-7-phenylheptanoate |
| SMILES | COc1cc(SC(CCCCc2ccccc2)CC(=O)OC(C)(C)C)ccc1OC1CCCC1 |
| InChI | InChI=1S/C29H40O4S/c1-29(2,3)33-28(30)21-24(17-11-8-14-22-12-6-5-7-13-22)34-25-18-19-26(27(20-25)31-4)32-23-15-9-10-16-23/h5-7,12-13,18-20,23-24H,8-11,14-17,21H2,1-4H3 |
| InChIKey | MIIAMMHOXYIUCD-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.70 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|