C9H9F3N2O4S — CID 106704457
6-methyl-2-oxo-4-(2,2,2-trifluoroethoxymethylsulfanyl)-1H-pyrimidine-5-carboxylic acid (PubChem CID 106704457) has the molecular formula C9H9F3N2O4S and a molecular weight of 298.24 g/mol. Its IUPAC name is 6-methyl-2-oxo-4-(2,2,2-trifluoroethoxymethylsulfanyl)-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 6-methyl-2-oxo-4-(2,2,2-trifluoroethoxymethylsulfanyl)-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 106704457 |
| Molecular Formula | C9H9F3N2O4S |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 6-methyl-2-oxo-4-(2,2,2-trifluoroethoxymethylsulfanyl)-1H-pyrimidine-5-carboxylic acid |
| SMILES | Cc1[nH]c(=O)nc(SCOCC(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C9H9F3N2O4S/c1-4-5(7(15)16)6(14-8(17)13-4)19-3-18-2-9(10,11)12/h2-3H2,1H3,(H,15,16)(H,13,14,17) |
| InChIKey | QTKPKQKGOADQOJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|