C9H13F3O3S — CID 106704472
2-[1-(2,2,2-trifluoroethoxymethylsulfanylmethyl)cyclopropyl]acetic acid (PubChem CID 106704472) has the molecular formula C9H13F3O3S and a molecular weight of 258.26 g/mol. Its IUPAC name is 2-[1-(2,2,2-trifluoroethoxymethylsulfanylmethyl)cyclopropyl]acetic acid.
| Compound Name | 2-[1-(2,2,2-trifluoroethoxymethylsulfanylmethyl)cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 106704472 |
| Molecular Formula | C9H13F3O3S |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-[1-(2,2,2-trifluoroethoxymethylsulfanylmethyl)cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(CSCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H13F3O3S/c10-9(11,12)4-15-6-16-5-8(1-2-8)3-7(13)14/h1-6H2,(H,13,14) |
| InChIKey | LZRPLZQBBWLPLS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|