C12H11ClF3NO2 — CID 106705438
[6-chloro-1-(2,2,2-trifluoroethoxymethyl)indol-3-yl]methanol (PubChem CID 106705438) has the molecular formula C12H11ClF3NO2 and a molecular weight of 293.67 g/mol. Its IUPAC name is [6-chloro-1-(2,2,2-trifluoroethoxymethyl)indol-3-yl]methanol.
| Compound Name | [6-chloro-1-(2,2,2-trifluoroethoxymethyl)indol-3-yl]methanol |
|---|---|
| PubChem CID | 106705438 |
| Molecular Formula | C12H11ClF3NO2 |
| Molecular Weight | 293.67 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | [6-chloro-1-(2,2,2-trifluoroethoxymethyl)indol-3-yl]methanol |
| SMILES | OCc1cn(COCC(F)(F)F)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C12H11ClF3NO2/c13-9-1-2-10-8(5-18)4-17(11(10)3-9)7-19-6-12(14,15)16/h1-4,18H,5-7H2 |
| InChIKey | QIGMWAKSRSSZFX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.67 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |