C17H21ClN2O — CID 106930200
N-[[6-chloro-1-(cyclopropylmethoxymethyl)indol-3-yl]methyl]cyclopropanamine (PubChem CID 106930200) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is N-[[6-chloro-1-(cyclopropylmethoxymethyl)indol-3-yl]methyl]cyclopropanamine.
| Compound Name | N-[[6-chloro-1-(cyclopropylmethoxymethyl)indol-3-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 106930200 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-[[6-chloro-1-(cyclopropylmethoxymethyl)indol-3-yl]methyl]cyclopropanamine |
| SMILES | Clc1ccc2c(CNC3CC3)cn(COCC3CC3)c2c1 |
| InChI | InChI=1S/C17H21ClN2O/c18-14-3-6-16-13(8-19-15-4-5-15)9-20(17(16)7-14)11-21-10-12-1-2-12/h3,6-7,9,12,15,19H,1-2,4-5,8,10-11H2 |
| InChIKey | ZONONHWATUKUHZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |