C11H12F4O2 — CID 106706505
2-(2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol (PubChem CID 106706505) has the molecular formula C11H12F4O2 and a molecular weight of 252.21 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol.
| Compound Name | 2-(2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol |
|---|---|
| PubChem CID | 106706505 |
| Molecular Formula | C11H12F4O2 |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-(2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol |
| SMILES | OCC(COCC(F)(F)F)c1ccccc1F |
| InChI | InChI=1S/C11H12F4O2/c12-10-4-2-1-3-9(10)8(5-16)6-17-7-11(13,14)15/h1-4,8,16H,5-7H2 |
| InChIKey | VONAVSNKAVLQQX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |