C14H19FO — CID 79448648
3-cyclopentyl-2-(2-fluorophenyl)propan-1-ol (PubChem CID 79448648) has the molecular formula C14H19FO and a molecular weight of 222.30 g/mol. Its IUPAC name is 3-cyclopentyl-2-(2-fluorophenyl)propan-1-ol.
| Compound Name | 3-cyclopentyl-2-(2-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 79448648 |
| Molecular Formula | C14H19FO |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-cyclopentyl-2-(2-fluorophenyl)propan-1-ol |
| SMILES | OCC(CC1CCCC1)c1ccccc1F |
| InChI | InChI=1S/C14H19FO/c15-14-8-4-3-7-13(14)12(10-16)9-11-5-1-2-6-11/h3-4,7-8,11-12,16H,1-2,5-6,9-10H2 |
| InChIKey | GEFPBCPKFJPNAR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |