C13H16ClF3O — CID 106706529
[1-chloro-2-(2,2,2-trifluoroethoxymethyl)butan-2-yl]benzene (PubChem CID 106706529) has the molecular formula C13H16ClF3O and a molecular weight of 280.72 g/mol. Its IUPAC name is [1-chloro-2-(2,2,2-trifluoroethoxymethyl)butan-2-yl]benzene.
| Compound Name | [1-chloro-2-(2,2,2-trifluoroethoxymethyl)butan-2-yl]benzene |
|---|---|
| PubChem CID | 106706529 |
| Molecular Formula | C13H16ClF3O |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | [1-chloro-2-(2,2,2-trifluoroethoxymethyl)butan-2-yl]benzene |
| SMILES | CCC(CCl)(COCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H16ClF3O/c1-2-12(8-14,9-18-10-13(15,16)17)11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3 |
| InChIKey | FQKDRAAZJLBLFG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|