C14H17Cl2F3O — CID 79447378
[2,2-bis(chloromethyl)-4-(2,2,2-trifluoroethoxy)butyl]benzene (PubChem CID 79447378) has the molecular formula C14H17Cl2F3O and a molecular weight of 329.19 g/mol. Its IUPAC name is [2,2-bis(chloromethyl)-4-(2,2,2-trifluoroethoxy)butyl]benzene.
| Compound Name | [2,2-bis(chloromethyl)-4-(2,2,2-trifluoroethoxy)butyl]benzene |
|---|---|
| PubChem CID | 79447378 |
| Molecular Formula | C14H17Cl2F3O |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | [2,2-bis(chloromethyl)-4-(2,2,2-trifluoroethoxy)butyl]benzene |
| SMILES | FC(F)(F)COCCC(CCl)(CCl)Cc1ccccc1 |
| InChI | InChI=1S/C14H17Cl2F3O/c15-9-13(10-16,6-7-20-11-14(17,18)19)8-12-4-2-1-3-5-12/h1-5H,6-11H2 |
| InChIKey | RZYLFWMIDHJPJS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|