C16H24Br2O — CID 79453191
[2,2-bis(bromomethyl)-4-butoxybutyl]benzene (PubChem CID 79453191) has the molecular formula C16H24Br2O and a molecular weight of 392.18 g/mol. Its IUPAC name is [2,2-bis(bromomethyl)-4-butoxybutyl]benzene.
| Compound Name | [2,2-bis(bromomethyl)-4-butoxybutyl]benzene |
|---|---|
| PubChem CID | 79453191 |
| Molecular Formula | C16H24Br2O |
| Molecular Weight | 392.18 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | [2,2-bis(bromomethyl)-4-butoxybutyl]benzene |
| SMILES | CCCCOCCC(CBr)(CBr)Cc1ccccc1 |
| InChI | InChI=1S/C16H24Br2O/c1-2-3-10-19-11-9-16(13-17,14-18)12-15-7-5-4-6-8-15/h4-8H,2-3,9-14H2,1H3 |
| InChIKey | NICSSNASXYXRPN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.18 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|