C22H32N2O — CID 175956431
3-benzyl-5-butoxy-1-phenylpentane-2,2-diamine (PubChem CID 175956431) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is 3-benzyl-5-butoxy-1-phenylpentane-2,2-diamine.
| Compound Name | 3-benzyl-5-butoxy-1-phenylpentane-2,2-diamine |
|---|---|
| PubChem CID | 175956431 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 3-benzyl-5-butoxy-1-phenylpentane-2,2-diamine |
| SMILES | CCCCOCCC(Cc1ccccc1)C(N)(N)Cc1ccccc1 |
| InChI | InChI=1S/C22H32N2O/c1-2-3-15-25-16-14-21(17-19-10-6-4-7-11-19)22(23,24)18-20-12-8-5-9-13-20/h4-13,21H,2-3,14-18,23-24H2,1H3 |
| InChIKey | DOXFMDPDSSWQFG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|