C14H28N4O — CID 106708167
7-(6-amino-5,5-dimethylhexyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 106708167) has the molecular formula C14H28N4O and a molecular weight of 268.40 g/mol. Its IUPAC name is 7-(6-amino-5,5-dimethylhexyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-(6-amino-5,5-dimethylhexyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 106708167 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | 7-(6-amino-5,5-dimethylhexyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | CC(C)(CN)CCCCN1CCN2C(=O)NCC2C1 |
| InChI | InChI=1S/C14H28N4O/c1-14(2,11-15)5-3-4-6-17-7-8-18-12(10-17)9-16-13(18)19/h12H,3-11,15H2,1-2H3,(H,16,19) |
| InChIKey | HPVXKVBMIZXGOY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|