C12H24N4O — CID 79091862
7-(1-amino-3,3-dimethylbutan-2-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 79091862) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is 7-(1-amino-3,3-dimethylbutan-2-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-(1-amino-3,3-dimethylbutan-2-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 79091862 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | 7-(1-amino-3,3-dimethylbutan-2-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | CC(C)(C)C(CN)N1CCN2C(=O)NCC2C1 |
| InChI | InChI=1S/C12H24N4O/c1-12(2,3)10(6-13)15-4-5-16-9(8-15)7-14-11(16)17/h9-10H,4-8,13H2,1-3H3,(H,14,17) |
| InChIKey | YYVMBBIRNIGGFZ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |