C14H22N4O — CID 106710316
6-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylhexanenitrile (PubChem CID 106710316) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 6-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106710316 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 6-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylhexanenitrile |
| SMILES | CN(C)c1cnn(CCCCC(C)(C)C#N)c(=O)c1 |
| InChI | InChI=1S/C14H22N4O/c1-14(2,11-15)7-5-6-8-18-13(19)9-12(10-16-18)17(3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | AZZKNODYHXPYRU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|