C16H26N4O — CID 106710318
6-[4-(diethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylhexanenitrile (PubChem CID 106710318) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is 6-[4-(diethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[4-(diethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106710318 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 6-[4-(diethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylhexanenitrile |
| SMILES | CCN(CC)c1cnn(CCCCC(C)(C)C#N)c(=O)c1 |
| InChI | InChI=1S/C16H26N4O/c1-5-19(6-2)14-11-15(21)20(18-12-14)10-8-7-9-16(3,4)13-17/h11-12H,5-10H2,1-4H3 |
| InChIKey | UAPCJNYWNQWMRO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|