About 6-[3-(1-aminoethyl)pyrrol-1-yl]-2,2-dimethylhexanenitrile
6-[3-(1-aminoethyl)pyrrol-1-yl]-2,2-dimethylhexanenitrile (PubChem CID 106713566) has the molecular formula C14H23N3
and a molecular weight of 233.36 g/mol. Its IUPAC name is 6-[3-(1-aminoethyl)pyrrol-1-yl]-2,2-dimethylhexanenitrile.
Molecular Properties
| Compound Name | 6-[3-(1-aminoethyl)pyrrol-1-yl]-2,2-dimethylhexanenitrile |
| PubChem CID | 106713566 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 6-[3-(1-aminoethyl)pyrrol-1-yl]-2,2-dimethylhexanenitrile |
| SMILES | CC(N)c1ccn(CCCCC(C)(C)C#N)c1 |
| InChI | InChI=1S/C14H23N3/c1-12(16)13-6-9-17(10-13)8-5-4-7-14(2,3)11-15/h6,9-10,12H,4-5,7-8,16H2,1-3H3 |
| InChIKey | IGSDLFSJJBZTSH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[3-(1-aminoethyl)pyrrol-1-yl]-2,2-dimethylhexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(1-aminoethyl)pyrrol-1-yl]-2,2-dimethylhexanenitrile?
The IUPAC name of 6-[3-(1-aminoethyl)pyrrol-1-yl]-2,2-dimethylhexanenitrile (CID 106713566) is 6-[3-(1-aminoethyl)pyrrol-1-yl]-2,2-dimethylhexanenitrile.
What is the SMILES notation for 6-[3-(1-aminoethyl)pyrrol-1-yl]-2,2-dimethylhexanenitrile?
The canonical SMILES for 6-[3-(1-aminoethyl)pyrrol-1-yl]-2,2-dimethylhexanenitrile is CC(N)c1ccn(CCCCC(C)(C)C#N)c1.
What is the InChIKey of 6-[3-(1-aminoethyl)pyrrol-1-yl]-2,2-dimethylhexanenitrile?
The InChIKey is IGSDLFSJJBZTSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3/c1-12(16)13-6-9-17(10-13)8-5-4-7-14(2,3)11-15/h6,9-10,12H,4-5,7-8,16H2,1-3H3.
What are the key properties of 6-[3-(1-aminoethyl)pyrrol-1-yl]-2,2-dimethylhexanenitrile?
6-[3-(1-aminoethyl)pyrrol-1-yl]-2,2-dimethylhexanenitrile has a molecular weight of 233.36 g/mol, XLogP of 3.23, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(1-aminoethyl)pyrrol-1-yl]-2,2-dimethylhexanenitrile is sourced from PubChem (CID 106713566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).