C12H16IN3O — CID 106713673
6-(4-iodo-6-oxopyridazin-1-yl)-2,2-dimethylhexanenitrile (PubChem CID 106713673) has the molecular formula C12H16IN3O and a molecular weight of 345.18 g/mol. Its IUPAC name is 6-(4-iodo-6-oxopyridazin-1-yl)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(4-iodo-6-oxopyridazin-1-yl)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106713673 |
| Molecular Formula | C12H16IN3O |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 6-(4-iodo-6-oxopyridazin-1-yl)-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCn1ncc(I)cc1=O |
| InChI | InChI=1S/C12H16IN3O/c1-12(2,9-14)5-3-4-6-16-11(17)7-10(13)8-15-16/h7-8H,3-6H2,1-2H3 |
| InChIKey | DYAYHEKZMKQIBY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|