C21H38N4O7 — CID 10671574
4-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-4-oxobutanoic acid (PubChem CID 10671574) has the molecular formula C21H38N4O7 and a molecular weight of 458.56 g/mol. Its IUPAC name is 4-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-4-oxobutanoic acid.
| Compound Name | 4-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10671574 |
| Molecular Formula | C21H38N4O7 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 4-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCCCCNC(=O)CCC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H38N4O7/c1-20(2,3)31-18(29)24-17(25-19(30)32-21(4,5)6)23-14-10-8-7-9-13-22-15(26)11-12-16(27)28/h7-14H2,1-6H3,(H,22,26)(H,27,28)(H2,23,24,25,29,30) |
| InChIKey | SOLIHNPRTGUYLV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 155.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|