C11H11F3N4S — CID 106716261
6-(1-methylpyrazol-4-yl)-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione (PubChem CID 106716261) has the molecular formula C11H11F3N4S and a molecular weight of 288.30 g/mol. Its IUPAC name is 6-(1-methylpyrazol-4-yl)-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-(1-methylpyrazol-4-yl)-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106716261 |
| Molecular Formula | C11H11F3N4S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 6-(1-methylpyrazol-4-yl)-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione |
| SMILES | Cn1cc(-c2cc(=S)nc(CCC(F)(F)F)[nH]2)cn1 |
| InChI | InChI=1S/C11H11F3N4S/c1-18-6-7(5-15-18)8-4-10(19)17-9(16-8)2-3-11(12,13)14/h4-6H,2-3H2,1H3,(H,16,17,19) |
| InChIKey | NKSDYLXQJHPNAQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|