C12H14F2N4OS — CID 106716292
2-[2-(2,2-difluoroethoxy)ethyl]-6-(1-methylpyrazol-4-yl)-1H-pyrimidine-4-thione (PubChem CID 106716292) has the molecular formula C12H14F2N4OS and a molecular weight of 300.33 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-6-(1-methylpyrazol-4-yl)-1H-pyrimidine-4-thione.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6-(1-methylpyrazol-4-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106716292 |
| Molecular Formula | C12H14F2N4OS |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6-(1-methylpyrazol-4-yl)-1H-pyrimidine-4-thione |
| SMILES | Cn1cc(-c2cc(=S)nc(CCOCC(F)F)[nH]2)cn1 |
| InChI | InChI=1S/C12H14F2N4OS/c1-18-6-8(5-15-18)9-4-12(20)17-11(16-9)2-3-19-7-10(13)14/h4-6,10H,2-3,7H2,1H3,(H,16,17,20) |
| InChIKey | WOZMUVQTOASMPQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|