C12H13F3N4O2 — CID 136771694
4-(1-methylpyrazol-4-yl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 136771694) has the molecular formula C12H13F3N4O2 and a molecular weight of 302.26 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 4-(1-methylpyrazol-4-yl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136771694 |
| Molecular Formula | C12H13F3N4O2 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | Cn1cc(-c2cc(=O)[nH]c(CCOCC(F)(F)F)n2)cn1 |
| InChI | InChI=1S/C12H13F3N4O2/c1-19-6-8(5-16-19)9-4-11(20)18-10(17-9)2-3-21-7-12(13,14)15/h4-6H,2-3,7H2,1H3,(H,17,18,20) |
| InChIKey | HXDQIKMPWKXQBP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|