C11H11F3N4OS — CID 106716308
6-(1-methylpyrazol-4-yl)-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106716308) has the molecular formula C11H11F3N4OS and a molecular weight of 304.30 g/mol. Its IUPAC name is 6-(1-methylpyrazol-4-yl)-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-(1-methylpyrazol-4-yl)-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106716308 |
| Molecular Formula | C11H11F3N4OS |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 6-(1-methylpyrazol-4-yl)-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | Cn1cc(-c2cc(=S)nc(COCC(F)(F)F)[nH]2)cn1 |
| InChI | InChI=1S/C11H11F3N4OS/c1-18-4-7(3-15-18)8-2-10(20)17-9(16-8)5-19-6-11(12,13)14/h2-4H,5-6H2,1H3,(H,16,17,20) |
| InChIKey | MCXLIYMTEFYOSV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|