C12H14F2N4O2 — CID 136771823
2-[2-(2,2-difluoroethoxy)ethyl]-4-(1-methylpyrazol-4-yl)-1H-pyrimidin-6-one (PubChem CID 136771823) has the molecular formula C12H14F2N4O2 and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-4-(1-methylpyrazol-4-yl)-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-(1-methylpyrazol-4-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136771823 |
| Molecular Formula | C12H14F2N4O2 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-(1-methylpyrazol-4-yl)-1H-pyrimidin-6-one |
| SMILES | Cn1cc(-c2cc(=O)[nH]c(CCOCC(F)F)n2)cn1 |
| InChI | InChI=1S/C12H14F2N4O2/c1-18-6-8(5-15-18)9-4-12(19)17-11(16-9)2-3-20-7-10(13)14/h4-6,10H,2-3,7H2,1H3,(H,16,17,19) |
| InChIKey | HEDLZWNMTQAJQG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|