C25H40O6S — CID 10671995
3-ethoxypropyl (2S)-5-ethoxy-2-[(1S,2S)-1-hydroxy-2-[(R)-(4-methylphenyl)sulfinyl]cyclohexyl]pentanoate (PubChem CID 10671995) has the molecular formula C25H40O6S and a molecular weight of 468.66 g/mol. Its IUPAC name is 3-ethoxypropyl (2S)-5-ethoxy-2-[(1S,2S)-1-hydroxy-2-[(R)-(4-methylphenyl)sulfinyl]cyclohexyl]pentanoate.
| Compound Name | 3-ethoxypropyl (2S)-5-ethoxy-2-[(1S,2S)-1-hydroxy-2-[(R)-(4-methylphenyl)sulfinyl]cyclohexyl]pentanoate |
|---|---|
| PubChem CID | 10671995 |
| Molecular Formula | C25H40O6S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 3-ethoxypropyl (2S)-5-ethoxy-2-[(1S,2S)-1-hydroxy-2-[(R)-(4-methylphenyl)sulfinyl]cyclohexyl]pentanoate |
| SMILES | CCOCCCOC(=O)[C@@H](CCCOCC)[C@@]1(O)CCCC[C@@H]1[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H40O6S/c1-4-29-17-8-10-22(24(26)31-19-9-18-30-5-2)25(27)16-7-6-11-23(25)32(28)21-14-12-20(3)13-15-21/h12-15,22-23,27H,4-11,16-19H2,1-3H3/t22-,23+,25+,32+/m1/s1 |
| InChIKey | KTYFEFASESWSCC-PVQNCLDBSA-N |
| XLogP | 4.18 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|